C8H11F3N2O2 — CID 57008158
N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]-2,2,2-trifluoroacetamide (PubChem CID 57008158) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57008158 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H]1CN[C@H]2CCO[C@H]21)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2/c9-8(10,11)7(14)13-5-3-12-4-1-2-15-6(4)5/h4-6,12H,1-3H2,(H,13,14)/t4-,5+,6+/m0/s1 |
| InChIKey | HAOHLVTYOYVXBQ-KVQBGUIXSA-N |
| XLogP | -0.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |