C25H35NO4S — CID 57008579
methyl 7-[(1R,5R)-6,6-dimethyl-3-(2-phenylethylsulfonylamino)-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate (PubChem CID 57008579) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is methyl 7-[(1R,5R)-6,6-dimethyl-3-(2-phenylethylsulfonylamino)-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,5R)-6,6-dimethyl-3-(2-phenylethylsulfonylamino)-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate |
|---|---|
| PubChem CID | 57008579 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | methyl 7-[(1R,5R)-6,6-dimethyl-3-(2-phenylethylsulfonylamino)-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CCC1=C(NS(=O)(=O)CCc2ccccc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H35NO4S/c1-25(2)20-17-22(25)21(13-9-4-5-10-14-24(27)30-3)23(18-20)26-31(28,29)16-15-19-11-7-6-8-12-19/h4,6-9,11-12,20,22,26H,5,10,13-18H2,1-3H3/t20-,22+/m1/s1 |
| InChIKey | RAAAKOVGAPQYIA-IRLDBZIGSA-N |
| XLogP | 4.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|