About 7aH-[1,3,5]triazino[2,1-a]isoquinoline
7aH-[1,3,5]triazino[2,1-a]isoquinoline (PubChem CID 57009001) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 7aH-[1,3,5]triazino[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 7aH-[1,3,5]triazino[2,1-a]isoquinoline |
| PubChem CID | 57009001 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 7aH-[1,3,5]triazino[2,1-a]isoquinoline |
| SMILES | C1=CC2=C3N=CN=CN3C=CC2C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-10-9(3-1)5-6-14-8-12-7-13-11(10)14/h1-9H |
| InChIKey | ALVUMPOLCACGOO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7aH-[1,3,5]triazino[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-[1,3,5]triazino[2,1-a]isoquinoline?
The IUPAC name of 7aH-[1,3,5]triazino[2,1-a]isoquinoline (CID 57009001) is 7aH-[1,3,5]triazino[2,1-a]isoquinoline.
What is the SMILES notation for 7aH-[1,3,5]triazino[2,1-a]isoquinoline?
The canonical SMILES for 7aH-[1,3,5]triazino[2,1-a]isoquinoline is C1=CC2=C3N=CN=CN3C=CC2C=C1.
What is the InChIKey of 7aH-[1,3,5]triazino[2,1-a]isoquinoline?
The InChIKey is ALVUMPOLCACGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-4-10-9(3-1)5-6-14-8-12-7-13-11(10)14/h1-9H.
What are the key properties of 7aH-[1,3,5]triazino[2,1-a]isoquinoline?
7aH-[1,3,5]triazino[2,1-a]isoquinoline has a molecular weight of 183.21 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-[1,3,5]triazino[2,1-a]isoquinoline is sourced from PubChem (CID 57009001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).