C20H26O3 — CID 57009121
[(9S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 57009121) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(9S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(9S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 57009121 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(9S,13S,14S,17S)-13-methyl-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2C3=CCC4=C(CCC(=O)C4)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H26O3/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h5,16,18-19H,3-4,6-11H2,1-2H3/t16-,18+,19+,20+/m1/s1 |
| InChIKey | MANOURJMQMRXHI-GTAWCEEGSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|