C28H36FNO2 — CID 57009589
ethyl 3-[4-[11-(4-fluorophenyl)undec-10-enylamino]phenyl]prop-2-enoate (PubChem CID 57009589) has the molecular formula C28H36FNO2 and a molecular weight of 437.60 g/mol. Its IUPAC name is ethyl 3-[4-[11-(4-fluorophenyl)undec-10-enylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[11-(4-fluorophenyl)undec-10-enylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 57009589 |
| Molecular Formula | C28H36FNO2 |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | ethyl 3-[4-[11-(4-fluorophenyl)undec-10-enylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NCCCCCCCCCC=Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H36FNO2/c1-2-32-28(31)22-17-25-15-20-27(21-16-25)30-23-11-9-7-5-3-4-6-8-10-12-24-13-18-26(29)19-14-24/h10,12-22,30H,2-9,11,23H2,1H3 |
| InChIKey | MDSFTOFZFZQYBE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|