C15H17FN2O3S — CID 57010241
N-(2-ethoxy-4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanesulfonamide (PubChem CID 57010241) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2-ethoxy-4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanesulfonamide.
| Compound Name | N-(2-ethoxy-4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 57010241 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(2-ethoxy-4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanesulfonamide |
| SMILES | CCOc1cc(F)ccc1N(Cc1ccccn1)S(C)(=O)=O |
| InChI | InChI=1S/C15H17FN2O3S/c1-3-21-15-10-12(16)7-8-14(15)18(22(2,19)20)11-13-6-4-5-9-17-13/h4-10H,3,11H2,1-2H3 |
| InChIKey | VGEKHUNRDBCGBV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |