C16H23NOS — CID 57010390
7-methoxy-3-(methylsulfanylmethyl)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinoline (PubChem CID 57010390) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 7-methoxy-3-(methylsulfanylmethyl)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinoline.
| Compound Name | 7-methoxy-3-(methylsulfanylmethyl)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinoline |
|---|---|
| PubChem CID | 57010390 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 7-methoxy-3-(methylsulfanylmethyl)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinoline |
| SMILES | COc1ccc2c(c1)CC1CC(CSC)CNC1C2 |
| InChI | InChI=1S/C16H23NOS/c1-18-15-4-3-12-8-16-14(6-13(12)7-15)5-11(9-17-16)10-19-2/h3-4,7,11,14,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | PCBFDJJXJGXSPW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |