C27H28N4O2 — CID 57010460
2-N,2-N-dibenzyl-4-N-(2-methylpropyl)-3-nitroquinoline-2,4-diamine (PubChem CID 57010460) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)-3-nitroquinoline-2,4-diamine.
| Compound Name | 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)-3-nitroquinoline-2,4-diamine |
|---|---|
| PubChem CID | 57010460 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-N,2-N-dibenzyl-4-N-(2-methylpropyl)-3-nitroquinoline-2,4-diamine |
| SMILES | CC(C)CNc1c([N+](=O)[O-])c(N(Cc2ccccc2)Cc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H28N4O2/c1-20(2)17-28-25-23-15-9-10-16-24(23)29-27(26(25)31(32)33)30(18-21-11-5-3-6-12-21)19-22-13-7-4-8-14-22/h3-16,20H,17-19H2,1-2H3,(H,28,29) |
| InChIKey | ZAFRPVCGWKBGJZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|