C54H56N6O4+2 — CID 57010614
methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-7,12-bis(2-quinolin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 57010614) has the molecular formula C54H56N6O4+2 and a molecular weight of 853.08 g/mol. Its IUPAC name is methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-7,12-bis(2-quinolin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-7,12-bis(2-quinolin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 57010614 |
| Molecular Formula | C54H56N6O4+2 |
| Molecular Weight | 853.08 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-7,12-bis(2-quinolin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCc1c2[nH]c(c1C)C=c1[nH]c(c(CC[n+]3cccc4ccccc43)c1C)=Cc1[nH]c(c(CC[n+]3cccc4ccccc43)c1C)C=c1[nH]c(c(CCC(=O)OC)c1C)=C2 |
| InChI | InChI=1S/C54H56N6O4/c1-33-39(19-21-53(61)63-5)49-32-50-40(20-22-54(62)64-6)34(2)45(58-50)30-48-42(24-28-60-26-12-16-38-14-8-10-18-52(38)60)36(4)46(57-48)31-47-41(35(3)44(55-47)29-43(33)56-49)23-27-59-25-11-15-37-13-7-9-17-51(37)59/h7-18,25-26,29-32,55-58H,19-24,27-28H2,1-6H3/q+2 |
| InChIKey | IYIGWXKVNFXJFC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.08 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|