About 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine
2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine (PubChem CID 57010649) has the molecular formula C9H15BrN2
and a molecular weight of 231.14 g/mol. Its IUPAC name is 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine |
| PubChem CID | 57010649 |
| Molecular Formula | C9H15BrN2 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CC(CC)=CN(CC)C1Br |
| InChI | InChI=1S/C9H15BrN2/c1-3-7-5-8(11)9(10)12(4-2)6-7/h6,9,11H,3-5H2,1-2H3/b11-8+ |
| InChIKey | WQODPUAQMMUOMZ-DHZHZOJOSA-N |
| XLogP | 2.75 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine?
The IUPAC name of 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine (CID 57010649) is 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine.
What is the SMILES notation for 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine?
The canonical SMILES for 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine is [H]/N=C1\CC(CC)=CN(CC)C1Br.
What is the InChIKey of 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine?
The InChIKey is WQODPUAQMMUOMZ-DHZHZOJOSA-N. The full InChI is InChI=1S/C9H15BrN2/c1-3-7-5-8(11)9(10)12(4-2)6-7/h6,9,11H,3-5H2,1-2H3/b11-8+.
What are the key properties of 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine?
2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine has a molecular weight of 231.14 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,5-diethyl-2,4-dihydropyridin-3-imine is sourced from PubChem (CID 57010649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).