C14H18O4 — CID 57010753
(1R,9S)-7-hydroxy-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one (PubChem CID 57010753) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1R,9S)-7-hydroxy-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one.
| Compound Name | (1R,9S)-7-hydroxy-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one |
|---|---|
| PubChem CID | 57010753 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1R,9S)-7-hydroxy-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one |
| SMILES | CC1=C(C)[C@]23OC[C@](C)(CC(O)C2=C(C)C1=O)O3 |
| InChI | InChI=1S/C14H18O4/c1-7-9(3)14-11(8(2)12(7)16)10(15)5-13(4,18-14)6-17-14/h10,15H,5-6H2,1-4H3/t10?,13-,14+/m0/s1 |
| InChIKey | MGSRQYOUZQNJCH-INPHSSGZSA-N |
| XLogP | 1.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |