About 3-cyclopentylpyridazine
3-cyclopentylpyridazine (PubChem CID 57011827) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-cyclopentylpyridazine.
Molecular Properties
| Compound Name | 3-cyclopentylpyridazine |
| PubChem CID | 57011827 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-cyclopentylpyridazine |
| SMILES | c1cnnc(C2CCCC2)c1 |
| InChI | InChI=1S/C9H12N2/c1-2-5-8(4-1)9-6-3-7-10-11-9/h3,6-8H,1-2,4-5H2 |
| InChIKey | HNOIELPHTNNKIW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopentylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpyridazine?
The IUPAC name of 3-cyclopentylpyridazine (CID 57011827) is 3-cyclopentylpyridazine.
What is the SMILES notation for 3-cyclopentylpyridazine?
The canonical SMILES for 3-cyclopentylpyridazine is c1cnnc(C2CCCC2)c1.
What is the InChIKey of 3-cyclopentylpyridazine?
The InChIKey is HNOIELPHTNNKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-5-8(4-1)9-6-3-7-10-11-9/h3,6-8H,1-2,4-5H2.
What are the key properties of 3-cyclopentylpyridazine?
3-cyclopentylpyridazine has a molecular weight of 148.21 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpyridazine is sourced from PubChem (CID 57011827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).