C7H11F3O — CID 57011993
3-ethenoxy-1,1,4-trifluoropentane (PubChem CID 57011993) has the molecular formula C7H11F3O and a molecular weight of 168.16 g/mol. Its IUPAC name is 3-ethenoxy-1,1,4-trifluoropentane.
| Compound Name | 3-ethenoxy-1,1,4-trifluoropentane |
|---|---|
| PubChem CID | 57011993 |
| Molecular Formula | C7H11F3O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-ethenoxy-1,1,4-trifluoropentane |
| SMILES | C=COC(CC(F)F)C(C)F |
| InChI | InChI=1S/C7H11F3O/c1-3-11-6(5(2)8)4-7(9)10/h3,5-7H,1,4H2,2H3 |
| InChIKey | KNKCMYJTZIHJNL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|