C8H10Br2ClFO2 — CID 57012481
cis-(1R,3S)-3-(1,2-dibromo-2-chloro-2-fluoroethyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57012481) has the molecular formula C8H10Br2ClFO2 and a molecular weight of 352.43 g/mol. Its IUPAC name is cis-(1R,3S)-3-(1,2-dibromo-2-chloro-2-fluoroethyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(1,2-dibromo-2-chloro-2-fluoroethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57012481 |
| Molecular Formula | C8H10Br2ClFO2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 349.87 |
| IUPAC Name | cis-(1R,3S)-3-(1,2-dibromo-2-chloro-2-fluoroethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1C(Br)C(F)(Cl)Br |
| InChI | InChI=1S/C8H10Br2ClFO2/c1-7(2)3(4(7)6(13)14)5(9)8(10,11)12/h3-5H,1-2H3,(H,13,14)/t3-,4+,5?,8?/m1/s1 |
| InChIKey | GBGFOSFSXCKFED-ZBUJXXCOSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|