About 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine
2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine (PubChem CID 57012501) has the molecular formula C19H24F2N2
and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine.
Molecular Properties
| Compound Name | 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine |
| PubChem CID | 57012501 |
| Molecular Formula | C19H24F2N2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine |
| SMILES | CC(C)(N)CCC(CN)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24F2N2/c1-18(2,23)11-12-19(13-22,14-3-7-16(20)8-4-14)15-5-9-17(21)10-6-15/h3-10H,11-13,22-23H2,1-2H3 |
| InChIKey | CZWPALDERQISKX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine?
The IUPAC name of 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine (CID 57012501) is 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine.
What is the SMILES notation for 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine?
The canonical SMILES for 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine is CC(C)(N)CCC(CN)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine?
The InChIKey is CZWPALDERQISKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2/c1-18(2,23)11-12-19(13-22,14-3-7-16(20)8-4-14)15-5-9-17(21)10-6-15/h3-10H,11-13,22-23H2,1-2H3.
What are the key properties of 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine?
2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine has a molecular weight of 318.41 g/mol, XLogP of 3.73, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-fluorophenyl)-5-methylhexane-1,5-diamine is sourced from PubChem (CID 57012501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).