C6H6N4S6 — CID 57012659
5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 57012659) has the molecular formula C6H6N4S6 and a molecular weight of 326.54 g/mol. Its IUPAC name is 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 57012659 |
| Molecular Formula | C6H6N4S6 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]ethylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC(Sc1n[nH]c(=S)s1)Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C6H6N4S6/c1-2(13-5-9-7-3(11)15-5)14-6-10-8-4(12)16-6/h2H,1H3,(H,7,11)(H,8,12) |
| InChIKey | JKYHNYCDNGUQOR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|