C4BrF6I — CID 57013236
4-bromo-1,2,3,3,4,4-hexafluoro-1-iodobut-1-ene (PubChem CID 57013236) has the molecular formula C4BrF6I and a molecular weight of 368.84 g/mol. Its IUPAC name is 4-bromo-1,2,3,3,4,4-hexafluoro-1-iodobut-1-ene.
| Compound Name | 4-bromo-1,2,3,3,4,4-hexafluoro-1-iodobut-1-ene |
|---|---|
| PubChem CID | 57013236 |
| Molecular Formula | C4BrF6I |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 367.81 |
| IUPAC Name | 4-bromo-1,2,3,3,4,4-hexafluoro-1-iodobut-1-ene |
| SMILES | FC(I)=C(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C4BrF6I/c5-4(10,11)3(8,9)1(6)2(7)12 |
| InChIKey | FKYXMIYTMWXJOY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|