C14H20O — CID 57014002
5-butoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 57014002) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 5-butoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-butoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 57014002 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 5-butoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C14H20O/c1-2-3-11-15-14-10-6-8-12-7-4-5-9-13(12)14/h6,8,10H,2-5,7,9,11H2,1H3 |
| InChIKey | KDOQJYWAVVRCTH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|