C42H66N2O6 — CID 57014020
6-[3-(2-methyloctadec-9-enoyl)-1H-pyrrol-2-yl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]hexanoic acid (PubChem CID 57014020) has the molecular formula C42H66N2O6 and a molecular weight of 695.00 g/mol. Its IUPAC name is 6-[3-(2-methyloctadec-9-enoyl)-1H-pyrrol-2-yl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]hexanoic acid.
| Compound Name | 6-[3-(2-methyloctadec-9-enoyl)-1H-pyrrol-2-yl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 57014020 |
| Molecular Formula | C42H66N2O6 |
| Molecular Weight | 695.00 g/mol |
| Exact Mass | 694.49 |
| IUPAC Name | 6-[3-(2-methyloctadec-9-enoyl)-1H-pyrrol-2-yl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]hexanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC(C)C(=O)c1cc[nH]c1CCCC(CC(=O)O)c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C42H66N2O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-31(2)38(47)33-25-27-43-35(33)24-21-23-32(29-36(45)46)37-34(26-28-44-37)39(48)40-41(3,4)30-49-42(5,6)50-40/h14-15,25-28,31-32,40,43-44H,7-13,16-24,29-30H2,1-6H3,(H,45,46) |
| InChIKey | QMFCASBYTXCQNY-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.00 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|