About 3-(2H-pyran-6-yl)thiane 1-oxide
3-(2H-pyran-6-yl)thiane 1-oxide (PubChem CID 57014029) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-(2H-pyran-6-yl)thiane 1-oxide.
Molecular Properties
| Compound Name | 3-(2H-pyran-6-yl)thiane 1-oxide |
| PubChem CID | 57014029 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 3-(2H-pyran-6-yl)thiane 1-oxide |
| SMILES | O=S1CCCC(C2=CC=CCO2)C1 |
| InChI | InChI=1S/C10H14O2S/c11-13-7-3-4-9(8-13)10-5-1-2-6-12-10/h1-2,5,9H,3-4,6-8H2 |
| InChIKey | OSFRXRYXHBWPHM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2H-pyran-6-yl)thiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-pyran-6-yl)thiane 1-oxide?
The IUPAC name of 3-(2H-pyran-6-yl)thiane 1-oxide (CID 57014029) is 3-(2H-pyran-6-yl)thiane 1-oxide.
What is the SMILES notation for 3-(2H-pyran-6-yl)thiane 1-oxide?
The canonical SMILES for 3-(2H-pyran-6-yl)thiane 1-oxide is O=S1CCCC(C2=CC=CCO2)C1.
What is the InChIKey of 3-(2H-pyran-6-yl)thiane 1-oxide?
The InChIKey is OSFRXRYXHBWPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c11-13-7-3-4-9(8-13)10-5-1-2-6-12-10/h1-2,5,9H,3-4,6-8H2.
What are the key properties of 3-(2H-pyran-6-yl)thiane 1-oxide?
3-(2H-pyran-6-yl)thiane 1-oxide has a molecular weight of 198.29 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-pyran-6-yl)thiane 1-oxide is sourced from PubChem (CID 57014029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).