C19H27NO — CID 57014159
(8S,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-one (PubChem CID 57014159) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57014159 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (8S,9S,10R,13S,14S)-4-imino-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-5H-cyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C1\C(=O)C=C[C@@]2(C)C1CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO/c1-18-9-3-4-13(18)12-5-6-15-17(20)16(21)8-11-19(15,2)14(12)7-10-18/h8,11-15,20H,3-7,9-10H2,1-2H3/b20-17-/t12-,13-,14-,15?,18-,19+/m0/s1 |
| InChIKey | MJUSHUIRWMYJMO-RGVVYECMSA-N |
| XLogP | 4.39 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|