C10H17O9P — CID 57014596
2-methyl-3-[2-oxo-2-(3-phosphonopropoxy)ethyl]butanedioic acid (PubChem CID 57014596) has the molecular formula C10H17O9P and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-methyl-3-[2-oxo-2-(3-phosphonopropoxy)ethyl]butanedioic acid.
| Compound Name | 2-methyl-3-[2-oxo-2-(3-phosphonopropoxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 57014596 |
| Molecular Formula | C10H17O9P |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-methyl-3-[2-oxo-2-(3-phosphonopropoxy)ethyl]butanedioic acid |
| SMILES | CC(C(=O)O)C(CC(=O)OCCCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C10H17O9P/c1-6(9(12)13)7(10(14)15)5-8(11)19-3-2-4-20(16,17)18/h6-7H,2-5H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18) |
| InChIKey | CSTUIBIQEKXBNG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|