About 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine
3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine (PubChem CID 57014623) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine.
Analyze 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine?
The IUPAC name of 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine (CID 57014623) is 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine.
What is the SMILES notation for 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine?
The canonical SMILES for 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine is NCCCC1(CN)OCCO1.
What is the InChIKey of 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine?
The InChIKey is BNFJRGWVYAYINR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c8-3-1-2-7(6-9)10-4-5-11-7/h1-6,8-9H2.
What are the key properties of 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine?
3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine has a molecular weight of 160.22 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(aminomethyl)-1,3-dioxolan-2-yl]propan-1-amine is sourced from PubChem (CID 57014623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).