C21H15F2N4O2S4- — CID 57014902
2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-4-[3-(2,4-difluoro-N-sulfinatoanilino)phenyl]-1,3-thiazole (PubChem CID 57014902) has the molecular formula C21H15F2N4O2S4- and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-4-[3-(2,4-difluoro-N-sulfinatoanilino)phenyl]-1,3-thiazole.
| Compound Name | 2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-4-[3-(2,4-difluoro-N-sulfinatoanilino)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 57014902 |
| Molecular Formula | C21H15F2N4O2S4- |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-4-[3-(2,4-difluoro-N-sulfinatoanilino)phenyl]-1,3-thiazole |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(N(c4ccc(F)cc4F)S(=O)[O-])c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C21H16F2N4O2S4/c1-30-21-14(9-18(32-21)19(24)25)20-26-16(10-31-20)11-3-2-4-13(7-11)27(33(28)29)17-6-5-12(22)8-15(17)23/h2-10H,1H3,(H3,24,25)(H,28,29)/p-1 |
| InChIKey | URLQKYXYIYBEIJ-UHFFFAOYSA-M |
| XLogP | 5.75 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|