C21H29NO2 — CID 57015859
2-[[4-methoxy-2,6-di(propan-2-yl)phenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 57015859) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-[[4-methoxy-2,6-di(propan-2-yl)phenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | 2-[[4-methoxy-2,6-di(propan-2-yl)phenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 57015859 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-[[4-methoxy-2,6-di(propan-2-yl)phenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | COc1cc(C(C)C)c(C=C2C(=O)C3CCN2CC3)c(C(C)C)c1 |
| InChI | InChI=1S/C21H29NO2/c1-13(2)17-10-16(24-5)11-18(14(3)4)19(17)12-20-21(23)15-6-8-22(20)9-7-15/h10-15H,6-9H2,1-5H3 |
| InChIKey | RFWHEEWUEUMPAC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|