About 4H-isoindole
4H-isoindole (PubChem CID 57015883) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is 4H-isoindole.
Molecular Properties
| Compound Name | 4H-isoindole |
| PubChem CID | 57015883 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 4H-isoindole |
| SMILES | C1=CCC2=CN=CC2=C1 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-6-9-5-7(8)3-1/h1-3,5-6H,4H2 |
| InChIKey | VQYDPVKMWKWKPQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-isoindole?
The IUPAC name of 4H-isoindole (CID 57015883) is 4H-isoindole.
What is the SMILES notation for 4H-isoindole?
The canonical SMILES for 4H-isoindole is C1=CCC2=CN=CC2=C1.
What is the InChIKey of 4H-isoindole?
The InChIKey is VQYDPVKMWKWKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-2-4-8-6-9-5-7(8)3-1/h1-3,5-6H,4H2.
What are the key properties of 4H-isoindole?
4H-isoindole has a molecular weight of 117.15 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-isoindole is sourced from PubChem (CID 57015883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).