C8H10Cl2O — CID 57016024
2,2-dichloro-1-cyclohex-2-en-1-ylethanone (PubChem CID 57016024) has the molecular formula C8H10Cl2O and a molecular weight of 193.07 g/mol. Its IUPAC name is 2,2-dichloro-1-cyclohex-2-en-1-ylethanone.
| Compound Name | 2,2-dichloro-1-cyclohex-2-en-1-ylethanone |
|---|---|
| PubChem CID | 57016024 |
| Molecular Formula | C8H10Cl2O |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2,2-dichloro-1-cyclohex-2-en-1-ylethanone |
| SMILES | O=C(C(Cl)Cl)C1C=CCCC1 |
| InChI | InChI=1S/C8H10Cl2O/c9-8(10)7(11)6-4-2-1-3-5-6/h2,4,6,8H,1,3,5H2 |
| InChIKey | XXKAQZZRCUAXAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|