C21H42O4Si2 — CID 57016053
[(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate (PubChem CID 57016053) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is [(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate.
| Compound Name | [(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 57016053 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si2/c1-16(22)23-15-17-12-13-18(24-26(8,9)20(2,3)4)14-19(17)25-27(10,11)21(5,6)7/h12,18-19H,13-15H2,1-11H3/t18-,19+/m1/s1 |
| InChIKey | YPWOSZZWYWSMSP-MOPGFXCFSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|