C21H36O3 — CID 57016307
(1R,3aR,7aR)-7a-methyl-1-[5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pent-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 57016307) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pent-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pent-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 57016307 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pent-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C=CC[C@@]1(C)COC(C)(C)O1)[C@H]1CC[C@H]2C(O)CCC[C@]12C |
| InChI | InChI=1S/C21H36O3/c1-15(8-6-12-20(4)14-23-19(2,3)24-20)16-10-11-17-18(22)9-7-13-21(16,17)5/h6,8,15-18,22H,7,9-14H2,1-5H3/t15?,16-,17+,18?,20+,21-/m1/s1 |
| InChIKey | SGSFFHVOWWGNOJ-YTGSGFBOSA-N |
| XLogP | 4.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|