C15H13Cl2NO5 — CID 57016364
4-(2,3-dichlorophenyl)-2-formyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid (PubChem CID 57016364) has the molecular formula C15H13Cl2NO5 and a molecular weight of 358.18 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2-formyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2,3-dichlorophenyl)-2-formyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57016364 |
| Molecular Formula | C15H13Cl2NO5 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2-formyl-6-methyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C=O)C(C(=O)O)C(c2cccc(Cl)c2Cl)C1C(=O)O |
| InChI | InChI=1S/C15H13Cl2NO5/c1-6-10(14(20)21)11(7-3-2-4-8(16)13(7)17)12(15(22)23)9(5-19)18-6/h2-5,9-12H,1H3,(H,20,21)(H,22,23) |
| InChIKey | VUBORFSTUPZIEP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|