About 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal
10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal (PubChem CID 57016471) has the molecular formula C27H53N3O3
and a molecular weight of 467.74 g/mol. Its IUPAC name is 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal.
Molecular Properties
| Compound Name | 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal |
| PubChem CID | 57016471 |
| Molecular Formula | C27H53N3O3 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.41 |
| IUPAC Name | 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal |
| SMILES | CCCN(CCC)C(CC)C(C=O)C(=O)CC(CCC(=O)CC(CC)N(CC)CC)N(C)C |
| InChI | InChI=1S/C27H53N3O3/c1-9-17-30(18-10-2)26(12-4)25(21-31)27(33)20-23(28(7)8)15-16-24(32)19-22(11-3)29(13-5)14-6/h21-23,25-26H,9-20H2,1-8H3 |
| InChIKey | XKEHVIAXRMDLLZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal?
The IUPAC name of 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal (CID 57016471) is 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal.
What is the SMILES notation for 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal?
The canonical SMILES for 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal is CCCN(CCC)C(CC)C(C=O)C(=O)CC(CCC(=O)CC(CC)N(CC)CC)N(C)C.
What is the InChIKey of 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal?
The InChIKey is XKEHVIAXRMDLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H53N3O3/c1-9-17-30(18-10-2)26(12-4)25(21-31)27(33)20-23(28(7)8)15-16-24(32)19-22(11-3)29(13-5)14-6/h21-23,25-26H,9-20H2,1-8H3.
What are the key properties of 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal?
10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal has a molecular weight of 467.74 g/mol, XLogP of 4.45, 21 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(diethylamino)-5-(dimethylamino)-2-[1-(dipropylamino)propyl]-3,8-dioxododecanal is sourced from PubChem (CID 57016471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).