About 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid
5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid (PubChem CID 57016799) has the molecular formula C16H12FNO3
and a molecular weight of 285.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 57016799 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=CC(c2ccccc2)(c2ccc(F)cc2)ON1 |
| InChI | InChI=1S/C16H12FNO3/c17-13-8-6-12(7-9-13)16(11-4-2-1-3-5-11)10-14(15(19)20)18-21-16/h1-10,18H,(H,19,20) |
| InChIKey | VYGUZKIZWALUFT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid (CID 57016799) is 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid is O=C(O)C1=CC(c2ccccc2)(c2ccc(F)cc2)ON1.
What is the InChIKey of 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid?
The InChIKey is VYGUZKIZWALUFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO3/c17-13-8-6-12(7-9-13)16(11-4-2-1-3-5-11)10-14(15(19)20)18-21-16/h1-10,18H,(H,19,20).
What are the key properties of 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid?
5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid has a molecular weight of 285.27 g/mol, XLogP of 2.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-5-phenyl-2H-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 57016799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).