C21H35N — CID 57016887
(2R,7R)-7-hexyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile (PubChem CID 57016887) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (2R,7R)-7-hexyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile.
| Compound Name | (2R,7R)-7-hexyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 57016887 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (2R,7R)-7-hexyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonitrile |
| SMILES | CCCCCC[C@@H]1CCC2C(CCC3C[C@H](C#N)CCC32)C1 |
| InChI | InChI=1S/C21H35N/c1-2-3-4-5-6-16-7-11-20-18(13-16)9-10-19-14-17(15-22)8-12-21(19)20/h16-21H,2-14H2,1H3/t16-,17-,18?,19?,20?,21?/m1/s1 |
| InChIKey | IIISAAORZOBGGP-UFGADOCISA-N |
| XLogP | 6.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|