About (4-oxo-1,5-naphthyridin-1-yl) formate
(4-oxo-1,5-naphthyridin-1-yl) formate (PubChem CID 57016904) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is (4-oxo-1,5-naphthyridin-1-yl) formate.
Molecular Properties
| Compound Name | (4-oxo-1,5-naphthyridin-1-yl) formate |
| PubChem CID | 57016904 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | (4-oxo-1,5-naphthyridin-1-yl) formate |
| SMILES | O=COn1ccc(=O)c2ncccc21 |
| InChI | InChI=1S/C9H6N2O3/c12-6-14-11-5-3-8(13)9-7(11)2-1-4-10-9/h1-6H |
| InChIKey | SYSBDDOIMUOMHQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-1,5-naphthyridin-1-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1,5-naphthyridin-1-yl) formate?
The IUPAC name of (4-oxo-1,5-naphthyridin-1-yl) formate (CID 57016904) is (4-oxo-1,5-naphthyridin-1-yl) formate.
What is the SMILES notation for (4-oxo-1,5-naphthyridin-1-yl) formate?
The canonical SMILES for (4-oxo-1,5-naphthyridin-1-yl) formate is O=COn1ccc(=O)c2ncccc21.
What is the InChIKey of (4-oxo-1,5-naphthyridin-1-yl) formate?
The InChIKey is SYSBDDOIMUOMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-6-14-11-5-3-8(13)9-7(11)2-1-4-10-9/h1-6H.
What are the key properties of (4-oxo-1,5-naphthyridin-1-yl) formate?
(4-oxo-1,5-naphthyridin-1-yl) formate has a molecular weight of 190.16 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1,5-naphthyridin-1-yl) formate is sourced from PubChem (CID 57016904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).