C17H19N3O4 — CID 57017075
5-[4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-1-yl]-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 57017075) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-1-yl]-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-1-yl]-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 57017075 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-[4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridin-1-yl]-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2ccccc2)(N2CC=C(CCO)CC2)C(=O)N1 |
| InChI | InChI=1S/C17H19N3O4/c21-11-8-12-6-9-20(10-7-12)17(13-4-2-1-3-5-13)14(22)18-16(24)19-15(17)23/h1-6,21H,7-11H2,(H2,18,19,22,23,24) |
| InChIKey | ITBNTKPKUJAWIN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|