C8H4Cl2F12O — CID 57017093
4-chloro-2-(4-chloro-1,1,1,3,3,4-hexafluorobutan-2-yl)oxy-1,1,1,3,3,4-hexafluorobutane (PubChem CID 57017093) has the molecular formula C8H4Cl2F12O and a molecular weight of 415.00 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-1,1,1,3,3,4-hexafluorobutan-2-yl)oxy-1,1,1,3,3,4-hexafluorobutane.
| Compound Name | 4-chloro-2-(4-chloro-1,1,1,3,3,4-hexafluorobutan-2-yl)oxy-1,1,1,3,3,4-hexafluorobutane |
|---|---|
| PubChem CID | 57017093 |
| Molecular Formula | C8H4Cl2F12O |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 4-chloro-2-(4-chloro-1,1,1,3,3,4-hexafluorobutan-2-yl)oxy-1,1,1,3,3,4-hexafluorobutane |
| SMILES | FC(Cl)C(F)(F)C(OC(C(F)(F)F)C(F)(F)C(F)Cl)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F12O/c9-3(11)5(13,14)1(7(17,18)19)23-2(8(20,21)22)6(15,16)4(10)12/h1-4H |
| InChIKey | QPWPXKHBFOIUJA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|