C11H20O2 — CID 57017871
(4R,5S)-4-ethenyl-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane (PubChem CID 57017871) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4R,5S)-4-ethenyl-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane.
| Compound Name | (4R,5S)-4-ethenyl-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 57017871 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4R,5S)-4-ethenyl-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1CC(C)C |
| InChI | InChI=1S/C11H20O2/c1-6-9-10(7-8(2)3)13-11(4,5)12-9/h6,8-10H,1,7H2,2-5H3/t9-,10+/m1/s1 |
| InChIKey | MIMDHNWKNJCPAR-ZJUUUORDSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|