C11H15FN2O6 — CID 57018344
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethyl-3-fluoropyrimidine-2,4-dione (PubChem CID 57018344) has the molecular formula C11H15FN2O6 and a molecular weight of 290.25 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethyl-3-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethyl-3-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57018344 |
| Molecular Formula | C11H15FN2O6 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethyl-3-fluoropyrimidine-2,4-dione |
| SMILES | CCc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n(F)c1=O |
| InChI | InChI=1S/C11H15FN2O6/c1-2-5-3-13(11(19)14(12)9(5)18)10-8(17)7(16)6(4-15)20-10/h3,6-8,10,15-17H,2,4H2,1H3/t6-,7-,8+,10-/m1/s1 |
| InChIKey | QOQVBGSTHCZUME-BDNRQGISSA-N |
| XLogP | -2.08 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |