C44H36N8O — CID 57019708
3-[4-(10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl)phenoxy]propan-1-amine (PubChem CID 57019708) has the molecular formula C44H36N8O and a molecular weight of 692.83 g/mol. Its IUPAC name is 3-[4-(10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl)phenoxy]propan-1-amine.
| Compound Name | 3-[4-(10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 57019708 |
| Molecular Formula | C44H36N8O |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | 3-[4-(10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl)phenoxy]propan-1-amine |
| SMILES | NCCCOc1ccc(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccncc3)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H36N8O/c45-20-1-27-53-32-4-2-28(3-5-32)41-33-6-8-35(49-33)42(29-14-21-46-22-15-29)37-10-12-39(51-37)44(31-18-25-48-26-19-31)40-13-11-38(52-40)43(30-16-23-47-24-17-30)36-9-7-34(41)50-36/h2-19,21-26,49-52H,1,20,27,45H2 |
| InChIKey | PIEYCHBOZJGRME-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|