About [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane
[(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane (PubChem CID 57019934) has the molecular formula C41H38NP3
and a molecular weight of 637.68 g/mol. Its IUPAC name is [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane.
Molecular Properties
| Compound Name | [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane |
| PubChem CID | 57019934 |
| Molecular Formula | C41H38NP3 |
| Molecular Weight | 637.68 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane |
| SMILES | c1ccc(P(C[C@@H]2C[C@H](P(c3ccccc3)c3ccccc3)CN2P(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H38NP3/c1-7-19-35(20-8-1)43(36-21-9-2-10-22-36)33-34-31-41(44(37-23-11-3-12-24-37)38-25-13-4-14-26-38)32-42(34)45(39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,34,41H,31-33H2/t34-,41-/m0/s1 |
| InChIKey | HCLFRYSIMMZDAQ-GVICWXJLSA-N |
| XLogP | 7.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane?
The IUPAC name of [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane (CID 57019934) is [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane.
What is the SMILES notation for [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane?
The canonical SMILES for [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane is c1ccc(P(C[C@@H]2C[C@H](P(c3ccccc3)c3ccccc3)CN2P(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane?
The InChIKey is HCLFRYSIMMZDAQ-GVICWXJLSA-N. The full InChI is InChI=1S/C41H38NP3/c1-7-19-35(20-8-1)43(36-21-9-2-10-22-36)33-34-31-41(44(37-23-11-3-12-24-37)38-25-13-4-14-26-38)32-42(34)45(39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,34,41H,31-33H2/t34-,41-/m0/s1.
What are the key properties of [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane?
[(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane has a molecular weight of 637.68 g/mol, XLogP of 7.74, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-1,4-bis(diphenylphosphanyl)pyrrolidin-2-yl]methyl-diphenylphosphane is sourced from PubChem (CID 57019934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).