C15H24F5NO2S — CID 57019942
tert-butyl (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 57019942) has the molecular formula C15H24F5NO2S and a molecular weight of 377.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57019942 |
| Molecular Formula | C15H24F5NO2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | tert-butyl (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H24F5NO2S/c1-13(2,3)23-12(22)21-8-4-6-11(21)10-24-9-5-7-14(16,17)15(18,19)20/h11H,4-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | FTSJXCASBQUTIV-NSHDSACASA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|