C12H11F2N3O — CID 57020147
5-[[2-(2,4-difluorophenyl)-3-methyloxiran-2-yl]methyl]-1H-1,2,4-triazole (PubChem CID 57020147) has the molecular formula C12H11F2N3O and a molecular weight of 251.24 g/mol. Its IUPAC name is 5-[[2-(2,4-difluorophenyl)-3-methyloxiran-2-yl]methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[[2-(2,4-difluorophenyl)-3-methyloxiran-2-yl]methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 57020147 |
| Molecular Formula | C12H11F2N3O |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-[[2-(2,4-difluorophenyl)-3-methyloxiran-2-yl]methyl]-1H-1,2,4-triazole |
| SMILES | CC1OC1(Cc1ncn[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H11F2N3O/c1-7-12(18-7,5-11-15-6-16-17-11)9-3-2-8(13)4-10(9)14/h2-4,6-7H,5H2,1H3,(H,15,16,17) |
| InChIKey | CELQWGCDLCNKJC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|