C8H10O5 — CID 57020172
(5aR,9aS)-5a,6,7,8,9,9a-hexahydrobenzo[f][1,3,5]trioxepine-2,4-dione (PubChem CID 57020172) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is (5aR,9aS)-5a,6,7,8,9,9a-hexahydrobenzo[f][1,3,5]trioxepine-2,4-dione.
| Compound Name | (5aR,9aS)-5a,6,7,8,9,9a-hexahydrobenzo[f][1,3,5]trioxepine-2,4-dione |
|---|---|
| PubChem CID | 57020172 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (5aR,9aS)-5a,6,7,8,9,9a-hexahydrobenzo[f][1,3,5]trioxepine-2,4-dione |
| SMILES | O=C1OC(=O)O[C@@H]2CCCC[C@@H]2O1 |
| InChI | InChI=1S/C8H10O5/c9-7-11-5-3-1-2-4-6(5)12-8(10)13-7/h5-6H,1-4H2/t5-,6+ |
| InChIKey | XCPDMSMPGPJMRJ-OLQVQODUSA-N |
| XLogP | 1.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|