About chloro-tris(2,4,6-trifluorophenyl)silane
chloro-tris(2,4,6-trifluorophenyl)silane (PubChem CID 57020291) has the molecular formula C18H6ClF9Si
and a molecular weight of 456.77 g/mol. Its IUPAC name is chloro-tris(2,4,6-trifluorophenyl)silane.
Molecular Properties
| Compound Name | chloro-tris(2,4,6-trifluorophenyl)silane |
| PubChem CID | 57020291 |
| Molecular Formula | C18H6ClF9Si |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | chloro-tris(2,4,6-trifluorophenyl)silane |
| SMILES | Fc1cc(F)c([Si](Cl)(c2c(F)cc(F)cc2F)c2c(F)cc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H6ClF9Si/c19-29(16-10(23)1-7(20)2-11(16)24,17-12(25)3-8(21)4-13(17)26)18-14(27)5-9(22)6-15(18)28/h1-6H |
| InChIKey | JRJYZZCTPAXHMA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze chloro-tris(2,4,6-trifluorophenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-tris(2,4,6-trifluorophenyl)silane?
The IUPAC name of chloro-tris(2,4,6-trifluorophenyl)silane (CID 57020291) is chloro-tris(2,4,6-trifluorophenyl)silane.
What is the SMILES notation for chloro-tris(2,4,6-trifluorophenyl)silane?
The canonical SMILES for chloro-tris(2,4,6-trifluorophenyl)silane is Fc1cc(F)c([Si](Cl)(c2c(F)cc(F)cc2F)c2c(F)cc(F)cc2F)c(F)c1.
What is the InChIKey of chloro-tris(2,4,6-trifluorophenyl)silane?
The InChIKey is JRJYZZCTPAXHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H6ClF9Si/c19-29(16-10(23)1-7(20)2-11(16)24,17-12(25)3-8(21)4-13(17)26)18-14(27)5-9(22)6-15(18)28/h1-6H.
What are the key properties of chloro-tris(2,4,6-trifluorophenyl)silane?
chloro-tris(2,4,6-trifluorophenyl)silane has a molecular weight of 456.77 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-tris(2,4,6-trifluorophenyl)silane is sourced from PubChem (CID 57020291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).