About 4-(oxiran-2-yl)heptane-1,7-diamine
4-(oxiran-2-yl)heptane-1,7-diamine (PubChem CID 57020491) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-(oxiran-2-yl)heptane-1,7-diamine.
Molecular Properties
| Compound Name | 4-(oxiran-2-yl)heptane-1,7-diamine |
| PubChem CID | 57020491 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 4-(oxiran-2-yl)heptane-1,7-diamine |
| SMILES | NCCCC(CCCN)C1CO1 |
| InChI | InChI=1S/C9H20N2O/c10-5-1-3-8(4-2-6-11)9-7-12-9/h8-9H,1-7,10-11H2 |
| InChIKey | FQUIIGGRLGAFCL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxiran-2-yl)heptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxiran-2-yl)heptane-1,7-diamine?
The IUPAC name of 4-(oxiran-2-yl)heptane-1,7-diamine (CID 57020491) is 4-(oxiran-2-yl)heptane-1,7-diamine.
What is the SMILES notation for 4-(oxiran-2-yl)heptane-1,7-diamine?
The canonical SMILES for 4-(oxiran-2-yl)heptane-1,7-diamine is NCCCC(CCCN)C1CO1.
What is the InChIKey of 4-(oxiran-2-yl)heptane-1,7-diamine?
The InChIKey is FQUIIGGRLGAFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c10-5-1-3-8(4-2-6-11)9-7-12-9/h8-9H,1-7,10-11H2.
What are the key properties of 4-(oxiran-2-yl)heptane-1,7-diamine?
4-(oxiran-2-yl)heptane-1,7-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.48, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxiran-2-yl)heptane-1,7-diamine is sourced from PubChem (CID 57020491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).