C22H33NO — CID 57020497
(10bS)-4-(2-cyclohexylethyl)-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one (PubChem CID 57020497) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (10bS)-4-(2-cyclohexylethyl)-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one.
| Compound Name | (10bS)-4-(2-cyclohexylethyl)-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
|---|---|
| PubChem CID | 57020497 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (10bS)-4-(2-cyclohexylethyl)-3-methyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
| SMILES | CC1CC[C@@H]2C(=CCC3C(=O)CC=CC32)N1CCC1CCCCC1 |
| InChI | InChI=1S/C22H33NO/c1-16-10-11-19-18-8-5-9-22(24)20(18)12-13-21(19)23(16)15-14-17-6-3-2-4-7-17/h5,8,13,16-20H,2-4,6-7,9-12,14-15H2,1H3/t16?,18?,19-,20?/m0/s1 |
| InChIKey | XMUHDRHDZLPDJR-JATUMROWSA-N |
| XLogP | 5.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|