2,4-dihydroimidazole-3-carboxylic acid

C4H6N2O2 — CID 57020925

IUPAC2,4-dihydroimidazole-3-carboxylic acid
SMILESO=C(O)N1CC=NC1
InChIInChI=1S/C4H6N2O2/c7-4(8)6-2-1-5-3-6/h1H,2-3H2,(H,7,8)
InChIKeyCNOXWKFXVKUHNU-UHFFFAOYSA-N
MW114.10 g/mol
LogP0.01
Rot. Bonds

About 2,4-dihydroimidazole-3-carboxylic acid

2,4-dihydroimidazole-3-carboxylic acid (PubChem CID 57020925) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is 2,4-dihydroimidazole-3-carboxylic acid.

Molecular Properties

Compound Name2,4-dihydroimidazole-3-carboxylic acid
PubChem CID57020925
Molecular FormulaC4H6N2O2
Molecular Weight114.10 g/mol
Exact Mass114.04
IUPAC Name2,4-dihydroimidazole-3-carboxylic acid
SMILESO=C(O)N1CC=NC1
InChIInChI=1S/C4H6N2O2/c7-4(8)6-2-1-5-3-6/h1H,2-3H2,(H,7,8)
InChIKeyCNOXWKFXVKUHNU-UHFFFAOYSA-N
XLogP0.01
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.10
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,4-dihydroimidazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroimidazole-3-carboxylic acid?
The IUPAC name of 2,4-dihydroimidazole-3-carboxylic acid (CID 57020925) is 2,4-dihydroimidazole-3-carboxylic acid.
What is the SMILES notation for 2,4-dihydroimidazole-3-carboxylic acid?
The canonical SMILES for 2,4-dihydroimidazole-3-carboxylic acid is O=C(O)N1CC=NC1.
What is the InChIKey of 2,4-dihydroimidazole-3-carboxylic acid?
The InChIKey is CNOXWKFXVKUHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c7-4(8)6-2-1-5-3-6/h1H,2-3H2,(H,7,8).
What are the key properties of 2,4-dihydroimidazole-3-carboxylic acid?
2,4-dihydroimidazole-3-carboxylic acid has a molecular weight of 114.10 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroimidazole-3-carboxylic acid is sourced from PubChem (CID 57020925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).