C8H11FO — CID 57021227
4-fluoroocta-3,5,6-trien-1-ol (PubChem CID 57021227) has the molecular formula C8H11FO and a molecular weight of 142.17 g/mol. Its IUPAC name is 4-fluoroocta-3,5,6-trien-1-ol.
| Compound Name | 4-fluoroocta-3,5,6-trien-1-ol |
|---|---|
| PubChem CID | 57021227 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 4-fluoroocta-3,5,6-trien-1-ol |
| SMILES | CC=C=CC(F)=CCCO |
| InChI | InChI=1S/C8H11FO/c1-2-3-5-8(9)6-4-7-10/h2,5-6,10H,4,7H2,1H3 |
| InChIKey | UGWHZEGGKWQPRS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|