About 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine
4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine (PubChem CID 57021475) has the molecular formula C20H42N4O
and a molecular weight of 354.58 g/mol. Its IUPAC name is 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine.
Molecular Properties
| Compound Name | 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine |
| PubChem CID | 57021475 |
| Molecular Formula | C20H42N4O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.34 |
| IUPAC Name | 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine |
| SMILES | CCC1CN(CCOCCN2CCN(CC)C(CC)C2)CCN1CC |
| InChI | InChI=1S/C20H42N4O/c1-5-19-17-21(9-11-23(19)7-3)13-15-25-16-14-22-10-12-24(8-4)20(6-2)18-22/h19-20H,5-18H2,1-4H3 |
| InChIKey | AJJLREXSDKBLMS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine?
The IUPAC name of 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine (CID 57021475) is 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine.
What is the SMILES notation for 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine?
The canonical SMILES for 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine is CCC1CN(CCOCCN2CCN(CC)C(CC)C2)CCN1CC.
What is the InChIKey of 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine?
The InChIKey is AJJLREXSDKBLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42N4O/c1-5-19-17-21(9-11-23(19)7-3)13-15-25-16-14-22-10-12-24(8-4)20(6-2)18-22/h19-20H,5-18H2,1-4H3.
What are the key properties of 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine?
4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine has a molecular weight of 354.58 g/mol, XLogP of 1.84, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-(3,4-diethylpiperazin-1-yl)ethoxy]ethyl]-1,2-diethylpiperazine is sourced from PubChem (CID 57021475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).