C17H32O9 — CID 57021586
[(2R,4R,5R,6R,7S)-6-acetyloxy-1,4,5,7,8-pentamethoxyoctan-2-yl] acetate (PubChem CID 57021586) has the molecular formula C17H32O9 and a molecular weight of 380.43 g/mol. Its IUPAC name is [(2R,4R,5R,6R,7S)-6-acetyloxy-1,4,5,7,8-pentamethoxyoctan-2-yl] acetate.
| Compound Name | [(2R,4R,5R,6R,7S)-6-acetyloxy-1,4,5,7,8-pentamethoxyoctan-2-yl] acetate |
|---|---|
| PubChem CID | 57021586 |
| Molecular Formula | C17H32O9 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(2R,4R,5R,6R,7S)-6-acetyloxy-1,4,5,7,8-pentamethoxyoctan-2-yl] acetate |
| SMILES | COC[C@@H](C[C@@H](OC)[C@@H](OC)[C@H](OC(C)=O)[C@H](COC)OC)OC(C)=O |
| InChI | InChI=1S/C17H32O9/c1-11(18)25-13(9-20-3)8-14(22-5)16(24-7)17(26-12(2)19)15(23-6)10-21-4/h13-17H,8-10H2,1-7H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | JWWKXLGZWWDFAY-NQNKBUKLSA-N |
| XLogP | 0.58 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |